About (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone
(6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone (PubChem CID 15952129) has the molecular formula C21H19ClN2O2
and a molecular weight of 366.85 g/mol. Its IUPAC name is (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone.
Molecular Properties
| Compound Name | (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone |
| PubChem CID | 15952129 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone |
| SMILES | O=C(c1c[nH]c2cc(Cl)ccc12)N1CCC2(CC1)COc1ccccc12 |
| InChI | InChI=1S/C21H19ClN2O2/c22-14-5-6-15-16(12-23-18(15)11-14)20(25)24-9-7-21(8-10-24)13-26-19-4-2-1-3-17(19)21/h1-6,11-12,23H,7-10,13H2 |
| InChIKey | SUXKVYXAHASVFV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The IUPAC name of (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone (CID 15952129) is (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone.
What is the SMILES notation for (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The canonical SMILES for (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone is O=C(c1c[nH]c2cc(Cl)ccc12)N1CCC2(CC1)COc1ccccc12.
What is the InChIKey of (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The InChIKey is SUXKVYXAHASVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN2O2/c22-14-5-6-15-16(12-23-18(15)11-14)20(25)24-9-7-21(8-10-24)13-26-19-4-2-1-3-17(19)21/h1-6,11-12,23H,7-10,13H2.
What are the key properties of (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
(6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone has a molecular weight of 366.85 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1H-indol-3-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone is sourced from PubChem (CID 15952129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).