About 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate
2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate (PubChem CID 15952311) has the molecular formula C27H30FNO2
and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate |
| PubChem CID | 15952311 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)OCCc3ccccn3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H30FNO2/c1-2-3-4-5-6-9-21-11-13-22(14-12-21)23-15-16-25(26(28)20-23)27(30)31-19-17-24-10-7-8-18-29-24/h7-8,10-16,18,20H,2-6,9,17,19H2,1H3 |
| InChIKey | PRIFDOMOKOSDBZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate?
The IUPAC name of 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate (CID 15952311) is 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate.
What is the SMILES notation for 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate?
The canonical SMILES for 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate is CCCCCCCc1ccc(-c2ccc(C(=O)OCCc3ccccn3)c(F)c2)cc1.
What is the InChIKey of 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate?
The InChIKey is PRIFDOMOKOSDBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30FNO2/c1-2-3-4-5-6-9-21-11-13-22(14-12-21)23-15-16-25(26(28)20-23)27(30)31-19-17-24-10-7-8-18-29-24/h7-8,10-16,18,20H,2-6,9,17,19H2,1H3.
What are the key properties of 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate?
2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate has a molecular weight of 419.54 g/mol, XLogP of 6.80, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 2-fluoro-4-(4-heptylphenyl)benzoate is sourced from PubChem (CID 15952311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).