C22H21F3N6O4 — CID 159523435
N-hydroxy-2-[6-(quinolin-2-ylmethylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 159523435) has the molecular formula C22H21F3N6O4 and a molecular weight of 490.44 g/mol. Its IUPAC name is N-hydroxy-2-[6-(quinolin-2-ylmethylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2-[6-(quinolin-2-ylmethylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159523435 |
| Molecular Formula | C22H21F3N6O4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-hydroxy-2-[6-(quinolin-2-ylmethylamino)-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1cnc(N2CC3C(C2)C3NCc2ccc3ccccc3n2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H20N6O2.C2HF3O2/c27-19(25-28)13-7-22-20(23-8-13)26-10-15-16(11-26)18(15)21-9-14-6-5-12-3-1-2-4-17(12)24-14;3-2(4,5)1(6)7/h1-8,15-16,18,21,28H,9-11H2,(H,25,27);(H,6,7) |
| InChIKey | MCCBKHJSNSFORA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|