C18H16N4O4S — CID 15952436
methyl 2-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 15952436) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is methyl 2-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 15952436 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | methyl 2-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)c2ccc3[nH]c4c(c3c2)C(C)CNC4=O)s1 |
| InChI | InChI=1S/C18H16N4O4S/c1-8-6-19-16(24)14-13(8)10-5-9(3-4-11(10)21-14)15(23)22-18-20-7-12(27-18)17(25)26-2/h3-5,7-8,21H,6H2,1-2H3,(H,19,24)(H,20,22,23) |
| InChIKey | MFUFGIWZXLEILE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|