About 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one
1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one (PubChem CID 15952658) has the molecular formula C17H15ClN4O
and a molecular weight of 326.79 g/mol. Its IUPAC name is 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one |
| PubChem CID | 15952658 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one |
| SMILES | O=C1CC(c2ccccc2)CN1Cc1cnc2ccc(Cl)nn12 |
| InChI | InChI=1S/C17H15ClN4O/c18-15-6-7-16-19-9-14(22(16)20-15)11-21-10-13(8-17(21)23)12-4-2-1-3-5-12/h1-7,9,13H,8,10-11H2 |
| InChIKey | OIROQURGSQOQFW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one?
The IUPAC name of 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one (CID 15952658) is 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one.
What is the SMILES notation for 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one?
The canonical SMILES for 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one is O=C1CC(c2ccccc2)CN1Cc1cnc2ccc(Cl)nn12.
What is the InChIKey of 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one?
The InChIKey is OIROQURGSQOQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O/c18-15-6-7-16-19-9-14(22(16)20-15)11-21-10-13(8-17(21)23)12-4-2-1-3-5-12/h1-7,9,13H,8,10-11H2.
What are the key properties of 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one?
1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one has a molecular weight of 326.79 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-chloroimidazo[1,2-b]pyridazin-3-yl)methyl]-4-phenylpyrrolidin-2-one is sourced from PubChem (CID 15952658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).