C19H15ClN4V — CID 159527409
3-(2-chlorophenyl)-N-(5-methyl-1H-pyrazol-3-yl)isoquinolin-1-amine;vanadium (PubChem CID 159527409) has the molecular formula C19H15ClN4V and a molecular weight of 385.75 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(5-methyl-1H-pyrazol-3-yl)isoquinolin-1-amine;vanadium.
| Compound Name | 3-(2-chlorophenyl)-N-(5-methyl-1H-pyrazol-3-yl)isoquinolin-1-amine;vanadium |
|---|---|
| PubChem CID | 159527409 |
| Molecular Formula | C19H15ClN4V |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(5-methyl-1H-pyrazol-3-yl)isoquinolin-1-amine;vanadium |
| SMILES | Cc1cc(Nc2nc(-c3ccccc3Cl)cc3ccccc23)n[nH]1.[V] |
| InChI | InChI=1S/C19H15ClN4.V/c1-12-10-18(24-23-12)22-19-14-7-3-2-6-13(14)11-17(21-19)15-8-4-5-9-16(15)20;/h2-11H,1H3,(H2,21,22,23,24); |
| InChIKey | ATECKKINAOBZEC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |