C30H23ClF3N3S — CID 159528366
1-[[3-[2-chloro-4-(trifluoromethyl)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-3-(2,6-dimethylphenyl)propane-2-thione (PubChem CID 159528366) has the molecular formula C30H23ClF3N3S and a molecular weight of 550.05 g/mol. Its IUPAC name is 1-[[3-[2-chloro-4-(trifluoromethyl)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-3-(2,6-dimethylphenyl)propane-2-thione.
| Compound Name | 1-[[3-[2-chloro-4-(trifluoromethyl)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-3-(2,6-dimethylphenyl)propane-2-thione |
|---|---|
| PubChem CID | 159528366 |
| Molecular Formula | C30H23ClF3N3S |
| Molecular Weight | 550.05 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 1-[[3-[2-chloro-4-(trifluoromethyl)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]-3-(2,6-dimethylphenyl)propane-2-thione |
| SMILES | Cc1cccc(C)c1CC(=S)C/N=C/c1ccc2c(ccc3c2ncn3-c2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C30H23ClF3N3S/c1-18-4-3-5-19(2)25(18)14-23(38)16-35-15-20-6-9-24-21(12-20)7-10-28-29(24)36-17-37(28)27-11-8-22(13-26(27)31)30(32,33)34/h3-13,15,17H,14,16H2,1-2H3/b35-15+ |
| InChIKey | MCRBRGVYJGJBJQ-PTEHHBOZSA-N |
| XLogP | 8.50 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.05 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|