C26H48O11 — CID 159529303
4,6-diacetyloxyoctan-2-yl acetate;ethenyl acetate;octane-2,4,6-triol (PubChem CID 159529303) has the molecular formula C26H48O11 and a molecular weight of 536.66 g/mol. Its IUPAC name is 4,6-diacetyloxyoctan-2-yl acetate;ethenyl acetate;octane-2,4,6-triol.
| Compound Name | 4,6-diacetyloxyoctan-2-yl acetate;ethenyl acetate;octane-2,4,6-triol |
|---|---|
| PubChem CID | 159529303 |
| Molecular Formula | C26H48O11 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 4,6-diacetyloxyoctan-2-yl acetate;ethenyl acetate;octane-2,4,6-triol |
| SMILES | C=COC(C)=O.CCC(CC(CC(C)OC(C)=O)OC(C)=O)OC(C)=O.CCC(O)CC(O)CC(C)O |
| InChI | InChI=1S/C14H24O6.C8H18O3.C4H6O2/c1-6-13(19-11(4)16)8-14(20-12(5)17)7-9(2)18-10(3)15;1-3-7(10)5-8(11)4-6(2)9;1-3-6-4(2)5/h9,13-14H,6-8H2,1-5H3;6-11H,3-5H2,1-2H3;3H,1H2,2H3 |
| InChIKey | MCUCGGSVUBXYDC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|