C17H29N7O — CID 159529697
3-(benzotriazol-1-yloxy)-1-N,1-N,2-N,2-N,2-N',2-N'-hexamethylpiperidine-1,2,2-triamine (PubChem CID 159529697) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is 3-(benzotriazol-1-yloxy)-1-N,1-N,2-N,2-N,2-N',2-N'-hexamethylpiperidine-1,2,2-triamine.
| Compound Name | 3-(benzotriazol-1-yloxy)-1-N,1-N,2-N,2-N,2-N',2-N'-hexamethylpiperidine-1,2,2-triamine |
|---|---|
| PubChem CID | 159529697 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 3-(benzotriazol-1-yloxy)-1-N,1-N,2-N,2-N,2-N',2-N'-hexamethylpiperidine-1,2,2-triamine |
| SMILES | CN(C)N1CCCC(On2nnc3ccccc32)C1(N(C)C)N(C)C |
| InChI | InChI=1S/C17H29N7O/c1-20(2)17(21(3)4)16(12-9-13-23(17)22(5)6)25-24-15-11-8-7-10-14(15)18-19-24/h7-8,10-11,16H,9,12-13H2,1-6H3 |
| InChIKey | MCVIYOHZFPVSPW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|