C23H21ClF3N5O5S — CID 159530139
2-chloro-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 159530139) has the molecular formula C23H21ClF3N5O5S and a molecular weight of 571.97 g/mol. Its IUPAC name is 2-chloro-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159530139 |
| Molecular Formula | C23H21ClF3N5O5S |
| Molecular Weight | 571.97 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 2-chloro-N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]quinoline-6-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | NN=Cc1cccc(CN2CC[C@H](NS(=O)(=O)c3ccc4nc(Cl)ccc4c3)C2=O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H20ClN5O3S.C2HF3O2/c22-20-7-4-16-11-17(5-6-18(16)25-20)31(29,30)26-19-8-9-27(21(19)28)13-15-3-1-2-14(10-15)12-24-23;3-2(4,5)1(6)7/h1-7,10-12,19,26H,8-9,13,23H2;(H,6,7)/t19-;/m0./s1 |
| InChIKey | MCWVBAXRXMURPL-FYZYNONXSA-N |
| XLogP | 2.89 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.97 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|