C11H14N2O — CID 159530417
6-propan-2-yloxy-1H-isoindol-5-amine (PubChem CID 159530417) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-propan-2-yloxy-1H-isoindol-5-amine.
| Compound Name | 6-propan-2-yloxy-1H-isoindol-5-amine |
|---|---|
| PubChem CID | 159530417 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-propan-2-yloxy-1H-isoindol-5-amine |
| SMILES | CC(C)Oc1cc2c(cc1N)C=NC2 |
| InChI | InChI=1S/C11H14N2O/c1-7(2)14-11-4-9-6-13-5-8(9)3-10(11)12/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | NZLYIBUWZCYKBS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|