C23H22BrF2N3 — CID 159531348
5-bromo-7-fluoro-2,3-dihydro-1H-inden-4-amine;7-fluoro-5-pyridin-3-yl-2,3-dihydro-1H-inden-4-amine (PubChem CID 159531348) has the molecular formula C23H22BrF2N3 and a molecular weight of 458.35 g/mol. Its IUPAC name is 5-bromo-7-fluoro-2,3-dihydro-1H-inden-4-amine;7-fluoro-5-pyridin-3-yl-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-bromo-7-fluoro-2,3-dihydro-1H-inden-4-amine;7-fluoro-5-pyridin-3-yl-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 159531348 |
| Molecular Formula | C23H22BrF2N3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 5-bromo-7-fluoro-2,3-dihydro-1H-inden-4-amine;7-fluoro-5-pyridin-3-yl-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(-c2cccnc2)cc(F)c2c1CCC2.Nc1c(Br)cc(F)c2c1CCC2 |
| InChI | InChI=1S/C14H13FN2.C9H9BrFN/c15-13-7-12(9-3-2-6-17-8-9)14(16)11-5-1-4-10(11)13;10-7-4-8(11)5-2-1-3-6(5)9(7)12/h2-3,6-8H,1,4-5,16H2;4H,1-3,12H2 |
| InChIKey | MDAOZROEDOJGGZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|