C19H16F3NO — CID 159532784
1-(8-methylidene-6,7-dihydro-5H-quinolin-5-yl)-3-(2,3,4-trifluorophenyl)propan-1-one (PubChem CID 159532784) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is 1-(8-methylidene-6,7-dihydro-5H-quinolin-5-yl)-3-(2,3,4-trifluorophenyl)propan-1-one.
| Compound Name | 1-(8-methylidene-6,7-dihydro-5H-quinolin-5-yl)-3-(2,3,4-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 159532784 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(8-methylidene-6,7-dihydro-5H-quinolin-5-yl)-3-(2,3,4-trifluorophenyl)propan-1-one |
| SMILES | C=C1CCC(C(=O)CCc2ccc(F)c(F)c2F)c2cccnc21 |
| InChI | InChI=1S/C19H16F3NO/c1-11-4-7-13(14-3-2-10-23-19(11)14)16(24)9-6-12-5-8-15(20)18(22)17(12)21/h2-3,5,8,10,13H,1,4,6-7,9H2 |
| InChIKey | MDFBOXDXBKCNNJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|