C12H2Cl2F4S4Zn2 — CID 159533512
dizinc;3,6-dichlorobenzene-1,2-dithiolate;3,4,5,6-tetrafluorobenzene-1,2-dithiolate (PubChem CID 159533512) has the molecular formula C12H2Cl2F4S4Zn2 and a molecular weight of 552.09 g/mol. Its IUPAC name is dizinc;3,6-dichlorobenzene-1,2-dithiolate;3,4,5,6-tetrafluorobenzene-1,2-dithiolate.
| Compound Name | dizinc;3,6-dichlorobenzene-1,2-dithiolate;3,4,5,6-tetrafluorobenzene-1,2-dithiolate |
|---|---|
| PubChem CID | 159533512 |
| Molecular Formula | C12H2Cl2F4S4Zn2 |
| Molecular Weight | 552.09 g/mol |
| Exact Mass | 547.69 |
| IUPAC Name | dizinc;3,6-dichlorobenzene-1,2-dithiolate;3,4,5,6-tetrafluorobenzene-1,2-dithiolate |
| SMILES | Fc1c(F)c(F)c([S-])c([S-])c1F.[S-]c1c(Cl)ccc(Cl)c1[S-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C6H4Cl2S2.C6H2F4S2.2Zn/c7-3-1-2-4(8)6(10)5(3)9;7-1-2(8)4(10)6(12)5(11)3(1)9;;/h1-2,9-10H;11-12H;;/q;;2*+2/p-4 |
| InChIKey | MDHKQAOCQUFDTF-UHFFFAOYSA-J |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.09 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|