C12H16O4 — CID 159533644
(3aS,5R,5aR,9aR)-3a-hydroxy-5-methoxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one (PubChem CID 159533644) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3aS,5R,5aR,9aR)-3a-hydroxy-5-methoxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one.
| Compound Name | (3aS,5R,5aR,9aR)-3a-hydroxy-5-methoxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one |
|---|---|
| PubChem CID | 159533644 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3aS,5R,5aR,9aR)-3a-hydroxy-5-methoxy-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-2-one |
| SMILES | CO[C@@H]1C[C@]2(O)CC(=O)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C12H16O4/c1-15-9-6-11(14)7-10(13)16-12(11)5-3-2-4-8(9)12/h2-3,8-9,14H,4-7H2,1H3/t8-,9-,11+,12-/m1/s1 |
| InChIKey | MDHVYLWKDYKJNY-PKZYVASSSA-N |
| XLogP | 0.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|