C16H21ClN4O — CID 15953426
3-[(1S,2R)-2-ethylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;hydrochloride (PubChem CID 15953426) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-[(1S,2R)-2-ethylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;hydrochloride.
| Compound Name | 3-[(1S,2R)-2-ethylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;hydrochloride |
|---|---|
| PubChem CID | 15953426 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[(1S,2R)-2-ethylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one;hydrochloride |
| SMILES | CC[C@@H]1CCCC[C@@H]1n1c(=O)[nH]c2cnc3[nH]ccc3c21.Cl |
| InChI | InChI=1S/C16H20N4O.ClH/c1-2-10-5-3-4-6-13(10)20-14-11-7-8-17-15(11)18-9-12(14)19-16(20)21;/h7-10,13H,2-6H2,1H3,(H,17,18)(H,19,21);1H/t10-,13+;/m1./s1 |
| InChIKey | GWFFMZWBGJCHRN-HTKOBJQYSA-N |
| XLogP | 3.77 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |