C14H25N — CID 159535362
(8aS)-2,5,5,6,8a-pentamethyl-3,4,4a,8-tetrahydro-1H-isoquinoline (PubChem CID 159535362) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (8aS)-2,5,5,6,8a-pentamethyl-3,4,4a,8-tetrahydro-1H-isoquinoline.
| Compound Name | (8aS)-2,5,5,6,8a-pentamethyl-3,4,4a,8-tetrahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 159535362 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (8aS)-2,5,5,6,8a-pentamethyl-3,4,4a,8-tetrahydro-1H-isoquinoline |
| SMILES | CC1=CC[C@]2(C)CN(C)CCC2C1(C)C |
| InChI | InChI=1S/C14H25N/c1-11-6-8-14(4)10-15(5)9-7-12(14)13(11,2)3/h6,12H,7-10H2,1-5H3/t12?,14-/m1/s1 |
| InChIKey | HYDJQJMBKAILRX-TYZXPVIJSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|