C17H20N2O2 — CID 159535411
tert-butyl 5-isocyano-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 159535411) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 5-isocyano-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-isocyano-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 159535411 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | tert-butyl 5-isocyano-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | [C-]#[N+]c1cccc2c1CC1CCN(C(=O)OC(C)(C)C)C21 |
| InChI | InChI=1S/C17H20N2O2/c1-17(2,3)21-16(20)19-9-8-11-10-13-12(15(11)19)6-5-7-14(13)18-4/h5-7,11,15H,8-10H2,1-3H3 |
| InChIKey | CUYFOHXXBOGNAD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|