About N,N-diethylethanamine;thiophene
N,N-diethylethanamine;thiophene (PubChem CID 159536832) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is N,N-diethylethanamine;thiophene.
Molecular Properties
| Compound Name | N,N-diethylethanamine;thiophene |
| PubChem CID | 159536832 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N,N-diethylethanamine;thiophene |
| SMILES | CCN(CC)CC.c1ccsc1 |
| InChI | InChI=1S/C6H15N.C4H4S/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H |
| InChIKey | MDRVQGBVZPRNIL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;thiophene?
The IUPAC name of N,N-diethylethanamine;thiophene (CID 159536832) is N,N-diethylethanamine;thiophene.
What is the SMILES notation for N,N-diethylethanamine;thiophene?
The canonical SMILES for N,N-diethylethanamine;thiophene is CCN(CC)CC.c1ccsc1.
What is the InChIKey of N,N-diethylethanamine;thiophene?
The InChIKey is MDRVQGBVZPRNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H4S/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H.
What are the key properties of N,N-diethylethanamine;thiophene?
N,N-diethylethanamine;thiophene has a molecular weight of 185.34 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;thiophene is sourced from PubChem (CID 159536832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).