C21H21BrN4O2 — CID 15953796
2-(9-bromo-6-oxo-7,12-dihydroindolo[3,2-d][1]benzazepin-5-yl)-N-[2-(methylamino)ethyl]acetamide (PubChem CID 15953796) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-(9-bromo-6-oxo-7,12-dihydroindolo[3,2-d][1]benzazepin-5-yl)-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | 2-(9-bromo-6-oxo-7,12-dihydroindolo[3,2-d][1]benzazepin-5-yl)-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 15953796 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-(9-bromo-6-oxo-7,12-dihydroindolo[3,2-d][1]benzazepin-5-yl)-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCNC(=O)CN1C(=O)Cc2c([nH]c3ccc(Br)cc23)-c2ccccc21 |
| InChI | InChI=1S/C21H21BrN4O2/c1-23-8-9-24-19(27)12-26-18-5-3-2-4-14(18)21-16(11-20(26)28)15-10-13(22)6-7-17(15)25-21/h2-7,10,23,25H,8-9,11-12H2,1H3,(H,24,27) |
| InChIKey | LCOBMQXUMDFUMW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|