C20H21F6NO2 — CID 15953841
4-[[N-butyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]phenol (PubChem CID 15953841) has the molecular formula C20H21F6NO2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 4-[[N-butyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]phenol.
| Compound Name | 4-[[N-butyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 15953841 |
| Molecular Formula | C20H21F6NO2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[[N-butyl-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]phenol |
| SMILES | CCCCN(Cc1ccc(O)cc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F6NO2/c1-2-3-12-27(13-14-4-10-17(28)11-5-14)16-8-6-15(7-9-16)18(29,19(21,22)23)20(24,25)26/h4-11,28-29H,2-3,12-13H2,1H3 |
| InChIKey | PZIHTPUCJUDWOV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|