About 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol
4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol (PubChem CID 15953864) has the molecular formula C13H15IN4O2
and a molecular weight of 386.19 g/mol. Its IUPAC name is 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol.
Molecular Properties
| Compound Name | 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol |
| PubChem CID | 15953864 |
| Molecular Formula | C13H15IN4O2 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol |
| SMILES | CC(C)c1cc(O)c(I)cc1Oc1cnc(N)nc1N |
| InChI | InChI=1S/C13H15IN4O2/c1-6(2)7-3-9(19)8(14)4-10(7)20-11-5-17-13(16)18-12(11)15/h3-6,19H,1-2H3,(H4,15,16,17,18) |
| InChIKey | QHEAZCABDDLXHC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol?
The IUPAC name of 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol (CID 15953864) is 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol.
What is the SMILES notation for 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol?
The canonical SMILES for 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol is CC(C)c1cc(O)c(I)cc1Oc1cnc(N)nc1N.
What is the InChIKey of 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol?
The InChIKey is QHEAZCABDDLXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15IN4O2/c1-6(2)7-3-9(19)8(14)4-10(7)20-11-5-17-13(16)18-12(11)15/h3-6,19H,1-2H3,(H4,15,16,17,18).
What are the key properties of 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol?
4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol has a molecular weight of 386.19 g/mol, XLogP of 2.87, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-diaminopyrimidin-5-yl)oxy-2-iodo-5-propan-2-ylphenol is sourced from PubChem (CID 15953864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).