C20H20BrN2O9P — CID 15953912
[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate (PubChem CID 15953912) has the molecular formula C20H20BrN2O9P and a molecular weight of 543.26 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 15953912 |
| Molecular Formula | C20H20BrN2O9P |
| Molecular Weight | 543.26 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)O[C@@H]1COP1(=O)OCc2ccccc2O1 |
| InChI | InChI=1S/C20H20BrN2O9P/c1-12(24)30-16-8-18(23-9-13(6-7-21)19(25)22-20(23)26)31-17(16)11-29-33(27)28-10-14-4-2-3-5-15(14)32-33/h2-7,9,16-18H,8,10-11H2,1H3,(H,22,25,26)/b7-6+/t16-,17+,18+,33?/m0/s1 |
| InChIKey | PRHKUJMNNZZOIW-LCCPYDFQSA-N |
| XLogP | 2.86 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|