C17H24O5 — CID 15953944
methyl (4S)-3,4-diformyl-4-hydroxy-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1-carboxylate (PubChem CID 15953944) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (4S)-3,4-diformyl-4-hydroxy-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1-carboxylate.
| Compound Name | methyl (4S)-3,4-diformyl-4-hydroxy-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 15953944 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (4S)-3,4-diformyl-4-hydroxy-4a,8,8-trimethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C1C=C(C=O)[C@](O)(C=O)C2(C)CCCC(C)(C)C12 |
| InChI | InChI=1S/C17H24O5/c1-15(2)6-5-7-16(3)13(15)12(14(20)22-4)8-11(9-18)17(16,21)10-19/h8-10,12-13,21H,5-7H2,1-4H3/t12?,13?,16?,17-/m1/s1 |
| InChIKey | QZFDOZWCSDCZGC-YAAHMLIESA-N |
| XLogP | 1.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|