C26H28N2O4 — CID 159539560
6-(cyclopropylmethoxy)-1H-indole-2-carbaldehyde;[6-(cyclopropylmethoxy)-1H-indol-2-yl]methanol (PubChem CID 159539560) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 6-(cyclopropylmethoxy)-1H-indole-2-carbaldehyde;[6-(cyclopropylmethoxy)-1H-indol-2-yl]methanol.
| Compound Name | 6-(cyclopropylmethoxy)-1H-indole-2-carbaldehyde;[6-(cyclopropylmethoxy)-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 159539560 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 6-(cyclopropylmethoxy)-1H-indole-2-carbaldehyde;[6-(cyclopropylmethoxy)-1H-indol-2-yl]methanol |
| SMILES | O=Cc1cc2ccc(OCC3CC3)cc2[nH]1.OCc1cc2ccc(OCC3CC3)cc2[nH]1 |
| InChI | InChI=1S/C13H15NO2.C13H13NO2/c2*15-7-11-5-10-3-4-12(6-13(10)14-11)16-8-9-1-2-9/h3-6,9,14-15H,1-2,7-8H2;3-7,9,14H,1-2,8H2 |
| InChIKey | MEAJOIIHIDUVAH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|