C16H17N5O — CID 159540241
4-[1-(1-ethoxyethyl)pyrazol-4-yl]-3-isocyano-7-methylpyrrolo[1,2-b]pyridazine (PubChem CID 159540241) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-[1-(1-ethoxyethyl)pyrazol-4-yl]-3-isocyano-7-methylpyrrolo[1,2-b]pyridazine.
| Compound Name | 4-[1-(1-ethoxyethyl)pyrazol-4-yl]-3-isocyano-7-methylpyrrolo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 159540241 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-[1-(1-ethoxyethyl)pyrazol-4-yl]-3-isocyano-7-methylpyrrolo[1,2-b]pyridazine |
| SMILES | [C-]#[N+]c1cnn2c(C)ccc2c1-c1cnn(C(C)OCC)c1 |
| InChI | InChI=1S/C16H17N5O/c1-5-22-12(3)20-10-13(8-18-20)16-14(17-4)9-19-21-11(2)6-7-15(16)21/h6-10,12H,5H2,1-3H3 |
| InChIKey | DJIIUXFRCNLZKA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|