C37H41N3O5S — CID 15954111
(2R,4S)-2-benzyl-5-[(3S)-3,5-dibenzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide (PubChem CID 15954111) has the molecular formula C37H41N3O5S and a molecular weight of 639.82 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-5-[(3S)-3,5-dibenzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-5-[(3S)-3,5-dibenzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 15954111 |
| Molecular Formula | C37H41N3O5S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | (2R,4S)-2-benzyl-5-[(3S)-3,5-dibenzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)[C@H](Cc1ccccc1)C[C@H](O)CN1[C@@H](Cc2ccccc2)CN(Cc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C37H41N3O5S/c41-33(22-31(20-27-12-4-1-5-13-27)37(43)38-36-34-19-11-10-18-30(34)23-35(36)42)26-40-32(21-28-14-6-2-7-15-28)25-39(46(40,44)45)24-29-16-8-3-9-17-29/h1-19,31-33,35-36,41-42H,20-26H2,(H,38,43)/t31-,32+,33+,35-,36+/m1/s1 |
| InChIKey | WALQPAXBTKJPQQ-HTQIHCHASA-N |
| XLogP | 4.04 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |