About methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate
methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate (PubChem CID 159541382) has the molecular formula C19H36O8
and a molecular weight of 392.49 g/mol. Its IUPAC name is methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate.
Molecular Properties
| Compound Name | methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate |
| PubChem CID | 159541382 |
| Molecular Formula | C19H36O8 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate |
| SMILES | C.C.C.CC[C@@H]1C(=O)O[C@H]1CC(=O)OC.CC[C@H]1OC(=O)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/2C8H12O4.3CH4/c1-3-6-5(8(10)12-6)4-7(9)11-2;1-3-5-6(12-8(5)10)4-7(9)11-2;;;/h2*5-6H,3-4H2,1-2H3;3*1H4/t2*5-,6-;;;/m10.../s1 |
| InChIKey | MEGIDLIHEMFGQT-DHDOMTOOSA-N |
| XLogP | 2.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate?
The IUPAC name of methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate (CID 159541382) is methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate.
What is the SMILES notation for methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate?
The canonical SMILES for methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate is C.C.C.CC[C@@H]1C(=O)O[C@H]1CC(=O)OC.CC[C@H]1OC(=O)[C@@H]1CC(=O)OC.
What is the InChIKey of methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate?
The InChIKey is MEGIDLIHEMFGQT-DHDOMTOOSA-N. The full InChI is InChI=1S/2C8H12O4.3CH4/c1-3-6-5(8(10)12-6)4-7(9)11-2;1-3-5-6(12-8(5)10)4-7(9)11-2;;;/h2*5-6H,3-4H2,1-2H3;3*1H4/t2*5-,6-;;;/m10.../s1.
What are the key properties of methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate?
methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate has a molecular weight of 392.49 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 2-[(2R,3R)-2-ethyl-4-oxooxetan-3-yl]acetate;methyl 2-[(2S,3S)-3-ethyl-4-oxooxetan-2-yl]acetate is sourced from PubChem (CID 159541382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).