C33H59N5O7 — CID 159541752
2-[4-[5-[2-[2-[[(1S,4E,8R)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]-2-oxopentyl]-10-ethyl-7-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 159541752) has the molecular formula C33H59N5O7 and a molecular weight of 637.86 g/mol. Its IUPAC name is 2-[4-[5-[2-[2-[[(1S,4E,8R)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]-2-oxopentyl]-10-ethyl-7-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[5-[2-[2-[[(1S,4E,8R)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]-2-oxopentyl]-10-ethyl-7-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 159541752 |
| Molecular Formula | C33H59N5O7 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 637.44 |
| IUPAC Name | 2-[4-[5-[2-[2-[[(1S,4E,8R)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethoxy]ethoxy]-2-oxopentyl]-10-ethyl-7-methyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCN1CCN(C)CCN(CC(=O)CCCOCCOCCNC(=O)OCC2[C@H]3CC/C=C\CC[C@@H]23)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C33H59N5O7/c1-3-36-15-13-35(2)14-16-37(19-20-38(18-17-36)26-32(40)41)25-28(39)9-8-21-43-23-24-44-22-12-34-33(42)45-27-31-29-10-6-4-5-7-11-30(29)31/h4-5,29-31H,3,6-27H2,1-2H3,(H,34,42)(H,40,41)/b5-4-/t29-,30+,31? |
| InChIKey | CHGPWVDFLZZOQK-YCYHJORHSA-N |
| XLogP | 2.04 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|