C12H22N2 — CID 159542211
benzene;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 159542211) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is benzene;N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | benzene;N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 159542211 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | benzene;N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C.c1ccccc1 |
| InChI | InChI=1S/C6H16N2.C6H6/c1-7(2)5-6-8(3)4;1-2-4-6-5-3-1/h5-6H2,1-4H3;1-6H |
| InChIKey | MEIYTMJRTCEKLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |