C18H24O5 — CID 15954357
(2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-phenyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 15954357) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-phenyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-phenyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 15954357 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-phenyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CC[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C18H24O5/c1-4-8-13-15(19-2)17(20-3)16-14(22-13)11-21-18(23-16)12-9-6-5-7-10-12/h4-7,9-10,13-18H,1,8,11H2,2-3H3/t13-,14+,15-,16+,17+,18+/m0/s1 |
| InChIKey | KGIMLNVFEUATOT-FQESAXDCSA-N |
| XLogP | 2.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|