C26H30O5 — CID 15954359
(2R,4aR,6S,7S,8R,8aR)-6-benzyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 15954359) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-6-benzyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-6-benzyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 15954359 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-6-benzyl-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CCO[C@@H]1[C@@H](OCC=C)[C@H](Cc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C26H30O5/c1-3-15-27-23-21(17-19-11-7-5-8-12-19)30-22-18-29-26(20-13-9-6-10-14-20)31-24(22)25(23)28-16-4-2/h3-14,21-26H,1-2,15-18H2/t21-,22+,23-,24+,25+,26+/m0/s1 |
| InChIKey | DNHGLADDEJOUOL-OMTFQZPVSA-N |
| XLogP | 4.25 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|