C29H40O5 — CID 15954364
(2R,4aR,6S,7S,8R,8aR)-7,8-dipentoxy-2,6-diphenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 15954364) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-7,8-dipentoxy-2,6-diphenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dipentoxy-2,6-diphenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 15954364 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dipentoxy-2,6-diphenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCCO[C@H]1[C@@H]2O[C@H](c3ccccc3)OC[C@H]2OC(c2ccccc2)[C@@H]1OCCCCC |
| InChI | InChI=1S/C29H40O5/c1-3-5-13-19-30-27-25(22-15-9-7-10-16-22)33-24-21-32-29(23-17-11-8-12-18-23)34-26(24)28(27)31-20-14-6-4-2/h7-12,15-18,24-29H,3-6,13-14,19-21H2,1-2H3/t24-,25?,26-,27+,28+,29-/m1/s1 |
| InChIKey | RSGKWGOWPCVURQ-PINVEWIKSA-N |
| XLogP | 6.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|