About 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate
2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate (PubChem CID 15954382) has the molecular formula C10H11F3N2O5
and a molecular weight of 296.20 g/mol. Its IUPAC name is 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate |
| PubChem CID | 15954382 |
| Molecular Formula | C10H11F3N2O5 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1cc(C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11F3N2O5/c1-6(16)20-3-2-19-5-15-4-7(10(11,12)13)8(17)14-9(15)18/h4H,2-3,5H2,1H3,(H,14,17,18) |
| InChIKey | AQDYCUIQNJMMLP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate?
The IUPAC name of 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate (CID 15954382) is 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate.
What is the SMILES notation for 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate?
The canonical SMILES for 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate is CC(=O)OCCOCn1cc(C(F)(F)F)c(=O)[nH]c1=O.
What is the InChIKey of 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate?
The InChIKey is AQDYCUIQNJMMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O5/c1-6(16)20-3-2-19-5-15-4-7(10(11,12)13)8(17)14-9(15)18/h4H,2-3,5H2,1H3,(H,14,17,18).
What are the key properties of 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate?
2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate has a molecular weight of 296.20 g/mol, XLogP of 0.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]methoxy]ethyl acetate is sourced from PubChem (CID 15954382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).