About 5-prop-2-ynoxy-1,2-dihydronaphthalene
5-prop-2-ynoxy-1,2-dihydronaphthalene (PubChem CID 159545401) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-prop-2-ynoxy-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-prop-2-ynoxy-1,2-dihydronaphthalene |
| PubChem CID | 159545401 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 5-prop-2-ynoxy-1,2-dihydronaphthalene |
| SMILES | C#CCOc1cccc2c1C=CCC2 |
| InChI | InChI=1S/C13H12O/c1-2-10-14-13-9-5-7-11-6-3-4-8-12(11)13/h1,4-5,7-9H,3,6,10H2 |
| InChIKey | FGFTUEMSAICXPG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-ynoxy-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-ynoxy-1,2-dihydronaphthalene?
The IUPAC name of 5-prop-2-ynoxy-1,2-dihydronaphthalene (CID 159545401) is 5-prop-2-ynoxy-1,2-dihydronaphthalene.
What is the SMILES notation for 5-prop-2-ynoxy-1,2-dihydronaphthalene?
The canonical SMILES for 5-prop-2-ynoxy-1,2-dihydronaphthalene is C#CCOc1cccc2c1C=CCC2.
What is the InChIKey of 5-prop-2-ynoxy-1,2-dihydronaphthalene?
The InChIKey is FGFTUEMSAICXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-2-10-14-13-9-5-7-11-6-3-4-8-12(11)13/h1,4-5,7-9H,3,6,10H2.
What are the key properties of 5-prop-2-ynoxy-1,2-dihydronaphthalene?
5-prop-2-ynoxy-1,2-dihydronaphthalene has a molecular weight of 184.24 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-ynoxy-1,2-dihydronaphthalene is sourced from PubChem (CID 159545401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).