C30H39FN2O4 — CID 159545755
2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159545755) has the molecular formula C30H39FN2O4 and a molecular weight of 510.65 g/mol. Its IUPAC name is 2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159545755 |
| Molecular Formula | C30H39FN2O4 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 2-[3-fluoro-2-(oxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cccc(F)c1C1CCCCO1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C30H39FN2O4/c31-25-11-7-10-24(28(25)27-13-4-6-19-37-27)29(30(34)35)33-17-16-23(20-33)36-18-5-3-9-22-15-14-21-8-1-2-12-26(21)32-22/h7,10-11,14-15,23,27,29H,1-6,8-9,12-13,16-20H2,(H,34,35)/t23-,27?,29?/m1/s1 |
| InChIKey | METVUSJPFRBEHD-FTPFQACPSA-N |
| XLogP | 5.58 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|