C21H15F3N2O — CID 159546657
1-(3-ethynylphenyl)-2-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]ethanone (PubChem CID 159546657) has the molecular formula C21H15F3N2O and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-2-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(3-ethynylphenyl)-2-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 159546657 |
| Molecular Formula | C21H15F3N2O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-(3-ethynylphenyl)-2-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]ethanone |
| SMILES | C#Cc1cccc(C(=O)Cc2cc(-n3cnc(C)c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H15F3N2O/c1-3-15-5-4-6-17(7-15)20(27)10-16-8-18(21(22,23)24)11-19(9-16)26-12-14(2)25-13-26/h1,4-9,11-13H,10H2,2H3 |
| InChIKey | NCSXMQCWIFBFQR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|