C19H22N4O2 — CID 15954666
3-[2,6-dimethyl-4-[3-(5-methylpyridazin-3-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 15954666) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[2,6-dimethyl-4-[3-(5-methylpyridazin-3-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[2,6-dimethyl-4-[3-(5-methylpyridazin-3-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15954666 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[2,6-dimethyl-4-[3-(5-methylpyridazin-3-yl)propoxy]phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1cnnc(CCCOc2cc(C)c(-c3noc(C)n3)c(C)c2)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-12-8-16(22-20-11-12)6-5-7-24-17-9-13(2)18(14(3)10-17)19-21-15(4)25-23-19/h8-11H,5-7H2,1-4H3 |
| InChIKey | MBFIDUZBCYAMOM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|