About 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate
4-(4-bromophenyl)-4-methylpiperidine;ethyl formate (PubChem CID 159546883) has the molecular formula C15H22BrNO2
and a molecular weight of 328.25 g/mol. Its IUPAC name is 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate |
| PubChem CID | 159546883 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate |
| SMILES | CC1(c2ccc(Br)cc2)CCNCC1.CCOC=O |
| InChI | InChI=1S/C12H16BrN.C3H6O2/c1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10;1-2-5-3-4/h2-5,14H,6-9H2,1H3;3H,2H2,1H3 |
| InChIKey | MEXGFZKNRMVZFE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate?
The IUPAC name of 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate (CID 159546883) is 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate.
What is the SMILES notation for 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate?
The canonical SMILES for 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate is CC1(c2ccc(Br)cc2)CCNCC1.CCOC=O.
What is the InChIKey of 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate?
The InChIKey is MEXGFZKNRMVZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrN.C3H6O2/c1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10;1-2-5-3-4/h2-5,14H,6-9H2,1H3;3H,2H2,1H3.
What are the key properties of 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate?
4-(4-bromophenyl)-4-methylpiperidine;ethyl formate has a molecular weight of 328.25 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-4-methylpiperidine;ethyl formate is sourced from PubChem (CID 159546883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).