C22H19BrF3N5O6S4 — CID 159547603
4-[S-(3-bromophenyl)-N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;trifluoro(hydroperoxy)methane (PubChem CID 159547603) has the molecular formula C22H19BrF3N5O6S4 and a molecular weight of 714.59 g/mol. Its IUPAC name is 4-[S-(3-bromophenyl)-N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;trifluoro(hydroperoxy)methane.
| Compound Name | 4-[S-(3-bromophenyl)-N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;trifluoro(hydroperoxy)methane |
|---|---|
| PubChem CID | 159547603 |
| Molecular Formula | C22H19BrF3N5O6S4 |
| Molecular Weight | 714.59 g/mol |
| Exact Mass | 712.94 |
| IUPAC Name | 4-[S-(3-bromophenyl)-N-[3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]sulfonylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;trifluoro(hydroperoxy)methane |
| SMILES | OOC(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=NS(=O)(=O)c2cccc(-c3nnc(C)o3)c2)c2cccc(Br)c2)c(SC)s1 |
| InChI | InChI=1S/C21H18BrN5O4S4.CHF3O2/c1-12-25-26-20(31-12)13-5-3-8-16(9-13)35(29,30)27-34(28,15-7-4-6-14(22)10-15)18-11-17(19(23)24)33-21(18)32-2;2-1(3,4)6-5/h3-11H,1-2H3,(H3,23,24);5H |
| InChIKey | MEZLNBXLXNMORN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|