About 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole
5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole (PubChem CID 15954776) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
| PubChem CID | 15954776 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCOc2c(C)cc(-c3nccn3C)cc2C)on1 |
| InChI | InChI=1S/C21H27N3O2/c1-15-12-18(21-22-9-10-24(21)4)13-16(2)20(15)25-11-7-5-6-8-19-14-17(3)23-26-19/h9-10,12-14H,5-8,11H2,1-4H3 |
| InChIKey | MYMGNSLFRMGJGC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole (CID 15954776) is 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole is Cc1cc(CCCCCOc2c(C)cc(-c3nccn3C)cc2C)on1.
What is the InChIKey of 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole?
The InChIKey is MYMGNSLFRMGJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c1-15-12-18(21-22-9-10-24(21)4)13-16(2)20(15)25-11-7-5-6-8-19-14-17(3)23-26-19/h9-10,12-14H,5-8,11H2,1-4H3.
What are the key properties of 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole?
5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole has a molecular weight of 353.47 g/mol, XLogP of 4.79, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[2,6-dimethyl-4-(1-methylimidazol-2-yl)phenoxy]pentyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 15954776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).