C20H36O3S2 — CID 159547812
nonyl(2-phenylethyl)sulfanium;propane-1-sulfonate (PubChem CID 159547812) has the molecular formula C20H36O3S2 and a molecular weight of 388.64 g/mol. Its IUPAC name is nonyl(2-phenylethyl)sulfanium;propane-1-sulfonate.
| Compound Name | nonyl(2-phenylethyl)sulfanium;propane-1-sulfonate |
|---|---|
| PubChem CID | 159547812 |
| Molecular Formula | C20H36O3S2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | nonyl(2-phenylethyl)sulfanium;propane-1-sulfonate |
| SMILES | CCCCCCCCC[SH+]CCc1ccccc1.CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H28S.C3H8O3S/c1-2-3-4-5-6-7-11-15-18-16-14-17-12-9-8-10-13-17;1-2-3-7(4,5)6/h8-10,12-13H,2-7,11,14-16H2,1H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | MFABUDMLSLYVIF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|