About N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide
N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide (PubChem CID 15954829) has the molecular formula C15H13Cl2N3OS
and a molecular weight of 354.26 g/mol. Its IUPAC name is N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide |
| PubChem CID | 15954829 |
| Molecular Formula | C15H13Cl2N3OS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N3OS/c1-9(21)18-11-3-5-12(6-4-11)19-15(22)20-14-8-10(16)2-7-13(14)17/h2-8H,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | XLLOIBXOZFLXKV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide?
The IUPAC name of N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide (CID 15954829) is N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide?
The canonical SMILES for N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide is CC(=O)Nc1ccc(NC(=S)Nc2cc(Cl)ccc2Cl)cc1.
What is the InChIKey of N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide?
The InChIKey is XLLOIBXOZFLXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3OS/c1-9(21)18-11-3-5-12(6-4-11)19-15(22)20-14-8-10(16)2-7-13(14)17/h2-8H,1H3,(H,18,21)(H2,19,20,22).
What are the key properties of N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide?
N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide has a molecular weight of 354.26 g/mol, XLogP of 4.76, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide is sourced from PubChem (CID 15954829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).