C23H31NOS — CID 159548850
2,3,4,5-tetradeuterio-6-[(9R)-9-[4-(3-methylthiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 159548850) has the molecular formula C23H31NOS and a molecular weight of 373.60 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-[(9R)-9-[4-(3-methylthiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine.
| Compound Name | 2,3,4,5-tetradeuterio-6-[(9R)-9-[4-(3-methylthiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
|---|---|
| PubChem CID | 159548850 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 373.60 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-[(9R)-9-[4-(3-methylthiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | [2H]c1nc([C@]2(CCCCc3sccc3C)CCOC3(CCCC3)C2)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C23H31NOS/c1-19-10-17-26-20(19)8-2-4-11-22(21-9-3-7-15-24-21)14-16-25-23(18-22)12-5-6-13-23/h3,7,9-10,15,17H,2,4-6,8,11-14,16,18H2,1H3/t22-/m1/s1/i3D,7D,9D,15D |
| InChIKey | MFDFMXBLKLUJCF-VINZIOMHSA-N |
| XLogP | 6.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|