C27H38N4O4 — CID 159548853
2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(6-methyl-1,3-benzodioxol-5-yl)amino]-N-pentylacetamide;methane (PubChem CID 159548853) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(6-methyl-1,3-benzodioxol-5-yl)amino]-N-pentylacetamide;methane.
| Compound Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(6-methyl-1,3-benzodioxol-5-yl)amino]-N-pentylacetamide;methane |
|---|---|
| PubChem CID | 159548853 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(6-methyl-1,3-benzodioxol-5-yl)amino]-N-pentylacetamide;methane |
| SMILES | C.CCCCCNC(=O)CN(CC(=O)N(C)N1Cc2ccccc2C1)c1cc2c(cc1C)OCO2 |
| InChI | InChI=1S/C26H34N4O4.CH4/c1-4-5-8-11-27-25(31)16-29(22-13-24-23(12-19(22)2)33-18-34-24)17-26(32)28(3)30-14-20-9-6-7-10-21(20)15-30;/h6-7,9-10,12-13H,4-5,8,11,14-18H2,1-3H3,(H,27,31);1H4 |
| InChIKey | MFDFZGOOYGBGDD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|