C13H20F2O4 — CID 159550863
(2S)-2-[2-(2,2-difluoropent-4-enoxy)-2-oxoethyl]-3,3-dimethylbutanoic acid (PubChem CID 159550863) has the molecular formula C13H20F2O4 and a molecular weight of 278.29 g/mol. Its IUPAC name is (2S)-2-[2-(2,2-difluoropent-4-enoxy)-2-oxoethyl]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[2-(2,2-difluoropent-4-enoxy)-2-oxoethyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 159550863 |
| Molecular Formula | C13H20F2O4 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S)-2-[2-(2,2-difluoropent-4-enoxy)-2-oxoethyl]-3,3-dimethylbutanoic acid |
| SMILES | C=CCC(F)(F)COC(=O)CC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H20F2O4/c1-5-6-13(14,15)8-19-10(16)7-9(11(17)18)12(2,3)4/h5,9H,1,6-8H2,2-4H3,(H,17,18) |
| InChIKey | XSHYWXIZHCUEAF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|