About bis(5-methylcyclopenta-1,3-diene);zirconium(4+)
bis(5-methylcyclopenta-1,3-diene);zirconium(4+) (PubChem CID 159550876) has the molecular formula C12H14Zr+2
and a molecular weight of 249.47 g/mol. Its IUPAC name is bis(5-methylcyclopenta-1,3-diene);zirconium(4+).
Molecular Properties
| Compound Name | bis(5-methylcyclopenta-1,3-diene);zirconium(4+) |
| PubChem CID | 159550876 |
| Molecular Formula | C12H14Zr+2 |
| Molecular Weight | 249.47 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | bis(5-methylcyclopenta-1,3-diene);zirconium(4+) |
| SMILES | C[c-]1cccc1.C[c-]1cccc1.[Zr+4] |
| InChI | InChI=1S/2C6H7.Zr/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3;/q2*-1;+4 |
| InChIKey | DRTQRQJHQJNTRV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(5-methylcyclopenta-1,3-diene);zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-methylcyclopenta-1,3-diene);zirconium(4+)?
The IUPAC name of bis(5-methylcyclopenta-1,3-diene);zirconium(4+) (CID 159550876) is bis(5-methylcyclopenta-1,3-diene);zirconium(4+).
What is the SMILES notation for bis(5-methylcyclopenta-1,3-diene);zirconium(4+)?
The canonical SMILES for bis(5-methylcyclopenta-1,3-diene);zirconium(4+) is C[c-]1cccc1.C[c-]1cccc1.[Zr+4].
What is the InChIKey of bis(5-methylcyclopenta-1,3-diene);zirconium(4+)?
The InChIKey is DRTQRQJHQJNTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7.Zr/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3;/q2*-1;+4.
What are the key properties of bis(5-methylcyclopenta-1,3-diene);zirconium(4+)?
bis(5-methylcyclopenta-1,3-diene);zirconium(4+) has a molecular weight of 249.47 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-methylcyclopenta-1,3-diene);zirconium(4+) is sourced from PubChem (CID 159550876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).