C29H26F4N4O2 — CID 159551188
3-(1-fluoroethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 159551188) has the molecular formula C29H26F4N4O2 and a molecular weight of 538.55 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 3-(1-fluoroethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 159551188 |
| Molecular Formula | C29H26F4N4O2 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-(1-fluoroethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC1CCCC(c2ccc(-c3c(F)ccc(F)c3F)c[n+]2[O-])c2cccc(c2)-c2c(cnn2C(C)F)NC1=O |
| InChI | InChI=1S/C29H26F4N4O2/c1-16-5-3-8-21(25-12-9-20(15-36(25)39)26-22(31)10-11-23(32)27(26)33)18-6-4-7-19(13-18)28-24(35-29(16)38)14-34-37(28)17(2)30/h4,6-7,9-17,21H,3,5,8H2,1-2H3,(H,35,38) |
| InChIKey | KPIYOAYDMNUSEI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|