C41H35Cl2NO6 — CID 159552335
9H-fluoren-9-ylmethyl carbonochloridate;9H-fluoren-9-ylmethyl (3R,5S)-3-(4-chlorophenyl)-5-(hydroxymethyl)morpholine-4-carboxylate (PubChem CID 159552335) has the molecular formula C41H35Cl2NO6 and a molecular weight of 708.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl carbonochloridate;9H-fluoren-9-ylmethyl (3R,5S)-3-(4-chlorophenyl)-5-(hydroxymethyl)morpholine-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl carbonochloridate;9H-fluoren-9-ylmethyl (3R,5S)-3-(4-chlorophenyl)-5-(hydroxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 159552335 |
| Molecular Formula | C41H35Cl2NO6 |
| Molecular Weight | 708.64 g/mol |
| Exact Mass | 707.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl carbonochloridate;9H-fluoren-9-ylmethyl (3R,5S)-3-(4-chlorophenyl)-5-(hydroxymethyl)morpholine-4-carboxylate |
| SMILES | O=C(Cl)OCC1c2ccccc2-c2ccccc21.O=C(OCC1c2ccccc2-c2ccccc21)N1[C@@H](CO)COC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClNO4.C15H11ClO2/c27-18-11-9-17(10-12-18)25-16-31-14-19(13-29)28(25)26(30)32-15-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24;16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-12,19,24-25,29H,13-16H2;1-8,14H,9H2/t19-,25-;/m0./s1 |
| InChIKey | MFNYNALDMNPUJE-FEINMWSASA-N |
| XLogP | 9.20 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.64 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|