About 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one
4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one (PubChem CID 15955378) has the molecular formula C16H29NO3S
and a molecular weight of 315.48 g/mol. Its IUPAC name is 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one |
| PubChem CID | 15955378 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one |
| SMILES | CCCCCCCCN1C(=O)CS(=O)(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H29NO3S/c1-2-3-4-5-6-10-13-17-15(18)14-21(19,20)16(17)11-8-7-9-12-16/h2-14H2,1H3 |
| InChIKey | CFTZJWKVHRTBML-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one?
The IUPAC name of 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one (CID 15955378) is 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one.
What is the SMILES notation for 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one?
The canonical SMILES for 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one is CCCCCCCCN1C(=O)CS(=O)(=O)C12CCCCC2.
What is the InChIKey of 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one?
The InChIKey is CFTZJWKVHRTBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3S/c1-2-3-4-5-6-10-13-17-15(18)14-21(19,20)16(17)11-8-7-9-12-16/h2-14H2,1H3.
What are the key properties of 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one?
4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one has a molecular weight of 315.48 g/mol, XLogP of 3.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octyl-1,1-dioxo-1λ6-thia-4-azaspiro[4.5]decan-3-one is sourced from PubChem (CID 15955378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).